C10H13N3O3 — CID 171513118
N-methyl-3-(4-nitrophenyl)-1,3-oxazolidin-4-amine (PubChem CID 171513118) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is N-methyl-3-(4-nitrophenyl)-1,3-oxazolidin-4-amine.
| Compound Name | N-methyl-3-(4-nitrophenyl)-1,3-oxazolidin-4-amine |
|---|---|
| PubChem CID | 171513118 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | N-methyl-3-(4-nitrophenyl)-1,3-oxazolidin-4-amine |
| SMILES | CNC1COCN1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H13N3O3/c1-11-10-6-16-7-12(10)8-2-4-9(5-3-8)13(14)15/h2-5,10-11H,6-7H2,1H3 |
| InChIKey | JWWWXFBDVJGLJD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|