C10H7N5O7 — CID 15863706
5-methyl-4,4-dinitro-2-(4-nitrophenyl)pyrazol-3-one (PubChem CID 15863706) has the molecular formula C10H7N5O7 and a molecular weight of 309.19 g/mol. Its IUPAC name is 5-methyl-4,4-dinitro-2-(4-nitrophenyl)pyrazol-3-one.
| Compound Name | 5-methyl-4,4-dinitro-2-(4-nitrophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 15863706 |
| Molecular Formula | C10H7N5O7 |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 5-methyl-4,4-dinitro-2-(4-nitrophenyl)pyrazol-3-one |
| SMILES | CC1=NN(c2ccc([N+](=O)[O-])cc2)C(=O)C1([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C10H7N5O7/c1-6-10(14(19)20,15(21)22)9(16)12(11-6)7-2-4-8(5-3-7)13(17)18/h2-5H,1H3 |
| InChIKey | WHBLLZNWXKAYMB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 162.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|