C10H8N4O5 — CID 7201535
(4S)-5-methyl-4-nitro-2-(4-nitrophenyl)-4H-pyrazol-3-one (PubChem CID 7201535) has the molecular formula C10H8N4O5 and a molecular weight of 264.20 g/mol. Its IUPAC name is (4S)-5-methyl-4-nitro-2-(4-nitrophenyl)-4H-pyrazol-3-one.
| Compound Name | (4S)-5-methyl-4-nitro-2-(4-nitrophenyl)-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 7201535 |
| Molecular Formula | C10H8N4O5 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | (4S)-5-methyl-4-nitro-2-(4-nitrophenyl)-4H-pyrazol-3-one |
| SMILES | CC1=NN(c2ccc([N+](=O)[O-])cc2)C(=O)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C10H8N4O5/c1-6-9(14(18)19)10(15)12(11-6)7-2-4-8(5-3-7)13(16)17/h2-5,9H,1H3/t9-/m0/s1 |
| InChIKey | OVFUUSPKWADLNJ-VIFPVBQESA-N |
| XLogP | 0.96 |
| TPSA | 118.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|