C20H15BrN4O5 — CID 93046484
(3R)-1-(4-bromophenyl)-3-[(4R)-3-methyl-1-(4-nitrophenyl)-5-oxo-4H-pyrazol-4-yl]pyrrolidine-2,5-dione (PubChem CID 93046484) has the molecular formula C20H15BrN4O5 and a molecular weight of 471.27 g/mol. Its IUPAC name is (3R)-1-(4-bromophenyl)-3-[(4R)-3-methyl-1-(4-nitrophenyl)-5-oxo-4H-pyrazol-4-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(4-bromophenyl)-3-[(4R)-3-methyl-1-(4-nitrophenyl)-5-oxo-4H-pyrazol-4-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 93046484 |
| Molecular Formula | C20H15BrN4O5 |
| Molecular Weight | 471.27 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | (3R)-1-(4-bromophenyl)-3-[(4R)-3-methyl-1-(4-nitrophenyl)-5-oxo-4H-pyrazol-4-yl]pyrrolidine-2,5-dione |
| SMILES | CC1=NN(c2ccc([N+](=O)[O-])cc2)C(=O)[C@@H]1[C@H]1CC(=O)N(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C20H15BrN4O5/c1-11-18(20(28)24(22-11)14-6-8-15(9-7-14)25(29)30)16-10-17(26)23(19(16)27)13-4-2-12(21)3-5-13/h2-9,16,18H,10H2,1H3/t16-,18+/m1/s1 |
| InChIKey | BZTYMHMXZSWART-AEFFLSMTSA-N |
| XLogP | 3.28 |
| TPSA | 113.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|