C20H15BrN4O6 — CID 124530386
ethyl (3aS,6aS)-5-(4-bromophenyl)-1-(4-nitrophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate (PubChem CID 124530386) has the molecular formula C20H15BrN4O6 and a molecular weight of 487.27 g/mol. Its IUPAC name is ethyl (3aS,6aS)-5-(4-bromophenyl)-1-(4-nitrophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate.
| Compound Name | ethyl (3aS,6aS)-5-(4-bromophenyl)-1-(4-nitrophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 124530386 |
| Molecular Formula | C20H15BrN4O6 |
| Molecular Weight | 487.27 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | ethyl (3aS,6aS)-5-(4-bromophenyl)-1-(4-nitrophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccc([N+](=O)[O-])cc2)[C@@H]2C(=O)N(c3ccc(Br)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C20H15BrN4O6/c1-2-31-20(28)16-15-17(24(22-16)13-7-9-14(10-8-13)25(29)30)19(27)23(18(15)26)12-5-3-11(21)4-6-12/h3-10,15,17H,2H2,1H3/t15-,17+/m1/s1 |
| InChIKey | LENFKXNPPHIGIG-WBVHZDCISA-N |
| XLogP | 2.65 |
| TPSA | 122.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|