C19H13BrN4O5 — CID 124530354
(3aR,6aR)-3-acetyl-5-(4-bromophenyl)-1-(3-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione (PubChem CID 124530354) has the molecular formula C19H13BrN4O5 and a molecular weight of 457.24 g/mol. Its IUPAC name is (3aR,6aR)-3-acetyl-5-(4-bromophenyl)-1-(3-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione.
| Compound Name | (3aR,6aR)-3-acetyl-5-(4-bromophenyl)-1-(3-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
|---|---|
| PubChem CID | 124530354 |
| Molecular Formula | C19H13BrN4O5 |
| Molecular Weight | 457.24 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | (3aR,6aR)-3-acetyl-5-(4-bromophenyl)-1-(3-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
| SMILES | CC(=O)C1=NN(c2cccc([N+](=O)[O-])c2)[C@H]2C(=O)N(c3ccc(Br)cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C19H13BrN4O5/c1-10(25)16-15-17(23(21-16)13-3-2-4-14(9-13)24(28)29)19(27)22(18(15)26)12-7-5-11(20)6-8-12/h2-9,15,17H,1H3/t15-,17+/m0/s1 |
| InChIKey | KZYCPWSVXQWNHE-DOTOQJQBSA-N |
| XLogP | 2.68 |
| TPSA | 113.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|