C20H15ClN4O5 — CID 124530356
(3aS,6aS)-3-acetyl-5-(3-chloro-2-methylphenyl)-1-(3-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione (PubChem CID 124530356) has the molecular formula C20H15ClN4O5 and a molecular weight of 426.82 g/mol. Its IUPAC name is (3aS,6aS)-3-acetyl-5-(3-chloro-2-methylphenyl)-1-(3-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione.
| Compound Name | (3aS,6aS)-3-acetyl-5-(3-chloro-2-methylphenyl)-1-(3-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
|---|---|
| PubChem CID | 124530356 |
| Molecular Formula | C20H15ClN4O5 |
| Molecular Weight | 426.82 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | (3aS,6aS)-3-acetyl-5-(3-chloro-2-methylphenyl)-1-(3-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
| SMILES | CC(=O)C1=NN(c2cccc([N+](=O)[O-])c2)[C@@H]2C(=O)N(c3cccc(Cl)c3C)C(=O)[C@H]12 |
| InChI | InChI=1S/C20H15ClN4O5/c1-10-14(21)7-4-8-15(10)23-19(27)16-17(11(2)26)22-24(18(16)20(23)28)12-5-3-6-13(9-12)25(29)30/h3-9,16,18H,1-2H3/t16-,18+/m1/s1 |
| InChIKey | PNECACSGKDMMOY-AEFFLSMTSA-N |
| XLogP | 2.88 |
| TPSA | 113.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.82 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|