C19H13Cl2N3O3 — CID 1036819
(3aS,6aR)-3-acetyl-5-(2-chlorophenyl)-1-(4-chlorophenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione (PubChem CID 1036819) has the molecular formula C19H13Cl2N3O3 and a molecular weight of 402.24 g/mol. Its IUPAC name is (3aS,6aR)-3-acetyl-5-(2-chlorophenyl)-1-(4-chlorophenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione.
| Compound Name | (3aS,6aR)-3-acetyl-5-(2-chlorophenyl)-1-(4-chlorophenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
|---|---|
| PubChem CID | 1036819 |
| Molecular Formula | C19H13Cl2N3O3 |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | (3aS,6aR)-3-acetyl-5-(2-chlorophenyl)-1-(4-chlorophenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
| SMILES | CC(=O)C1=NN(c2ccc(Cl)cc2)[C@H]2C(=O)N(c3ccccc3Cl)C(=O)[C@H]12 |
| InChI | InChI=1S/C19H13Cl2N3O3/c1-10(25)16-15-17(24(22-16)12-8-6-11(20)7-9-12)19(27)23(18(15)26)14-5-3-2-4-13(14)21/h2-9,15,17H,1H3/t15-,17-/m1/s1 |
| InChIKey | KAXLLGBUNXXNSL-NVXWUHKLSA-N |
| XLogP | 3.32 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|