C25H17Cl2N3O4 — CID 7056257
(3aR,6aR)-5-(2,5-dichlorophenyl)-3-(4-methoxybenzoyl)-1-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione (PubChem CID 7056257) has the molecular formula C25H17Cl2N3O4 and a molecular weight of 494.33 g/mol. Its IUPAC name is (3aR,6aR)-5-(2,5-dichlorophenyl)-3-(4-methoxybenzoyl)-1-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione.
| Compound Name | (3aR,6aR)-5-(2,5-dichlorophenyl)-3-(4-methoxybenzoyl)-1-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
|---|---|
| PubChem CID | 7056257 |
| Molecular Formula | C25H17Cl2N3O4 |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | (3aR,6aR)-5-(2,5-dichlorophenyl)-3-(4-methoxybenzoyl)-1-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
| SMILES | COc1ccc(C(=O)C2=NN(c3ccccc3)[C@H]3C(=O)N(c4cc(Cl)ccc4Cl)C(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C25H17Cl2N3O4/c1-34-17-10-7-14(8-11-17)23(31)21-20-22(30(28-21)16-5-3-2-4-6-16)25(33)29(24(20)32)19-13-15(26)9-12-18(19)27/h2-13,20,22H,1H3/t20-,22+/m0/s1 |
| InChIKey | BAEKZKFUOAAURM-RBBKRZOGSA-N |
| XLogP | 4.62 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|