C20H15Cl2N3O4 — CID 4679722
ethyl 5-(2-chlorophenyl)-1-(4-chlorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate (PubChem CID 4679722) has the molecular formula C20H15Cl2N3O4 and a molecular weight of 432.26 g/mol. Its IUPAC name is ethyl 5-(2-chlorophenyl)-1-(4-chlorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate.
| Compound Name | ethyl 5-(2-chlorophenyl)-1-(4-chlorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 4679722 |
| Molecular Formula | C20H15Cl2N3O4 |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | ethyl 5-(2-chlorophenyl)-1-(4-chlorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccc(Cl)cc2)C2C(=O)N(c3ccccc3Cl)C(=O)C12 |
| InChI | InChI=1S/C20H15Cl2N3O4/c1-2-29-20(28)16-15-17(25(23-16)12-9-7-11(21)8-10-12)19(27)24(18(15)26)14-6-4-3-5-13(14)22/h3-10,15,17H,2H2,1H3 |
| InChIKey | UJFAVKWSGGPLPF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|