C22H21N3O6 — CID 1418190
ethyl (3aS,6aR)-1,5-bis(2-methoxyphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate (PubChem CID 1418190) has the molecular formula C22H21N3O6 and a molecular weight of 423.43 g/mol. Its IUPAC name is ethyl (3aS,6aR)-1,5-bis(2-methoxyphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate.
| Compound Name | ethyl (3aS,6aR)-1,5-bis(2-methoxyphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 1418190 |
| Molecular Formula | C22H21N3O6 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | ethyl (3aS,6aR)-1,5-bis(2-methoxyphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccccc2OC)[C@H]2C(=O)N(c3ccccc3OC)C(=O)[C@H]12 |
| InChI | InChI=1S/C22H21N3O6/c1-4-31-22(28)18-17-19(25(23-18)14-10-6-8-12-16(14)30-3)21(27)24(20(17)26)13-9-5-7-11-15(13)29-2/h5-12,17,19H,4H2,1-3H3/t17-,19-/m1/s1 |
| InChIKey | QVJBNCUQBNXYME-IEBWSBKVSA-N |
| XLogP | 2.00 |
| TPSA | 97.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|