C13H9N5O7 — CID 41019720
methyl (3aR,6aR)-5-(3-nitrophenyl)-1-nitroso-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate (PubChem CID 41019720) has the molecular formula C13H9N5O7 and a molecular weight of 347.24 g/mol. Its IUPAC name is methyl (3aR,6aR)-5-(3-nitrophenyl)-1-nitroso-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate.
| Compound Name | methyl (3aR,6aR)-5-(3-nitrophenyl)-1-nitroso-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 41019720 |
| Molecular Formula | C13H9N5O7 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | methyl (3aR,6aR)-5-(3-nitrophenyl)-1-nitroso-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
| SMILES | COC(=O)C1=NN(N=O)[C@H]2C(=O)N(c3cccc([N+](=O)[O-])c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C13H9N5O7/c1-25-13(21)9-8-10(17(14-9)15-22)12(20)16(11(8)19)6-3-2-4-7(5-6)18(23)24/h2-5,8,10H,1H3/t8-,10+/m0/s1 |
| InChIKey | SCFRDJVEDKXJOP-WCBMZHEXSA-N |
| XLogP | -0.02 |
| TPSA | 151.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|