C14H12N4O5 — CID 7480948
methyl (3aS,6aR)-5-(3-methylphenyl)-1-nitroso-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate (PubChem CID 7480948) has the molecular formula C14H12N4O5 and a molecular weight of 316.27 g/mol. Its IUPAC name is methyl (3aS,6aR)-5-(3-methylphenyl)-1-nitroso-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate.
| Compound Name | methyl (3aS,6aR)-5-(3-methylphenyl)-1-nitroso-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 7480948 |
| Molecular Formula | C14H12N4O5 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | methyl (3aS,6aR)-5-(3-methylphenyl)-1-nitroso-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-c]pyrazole-3-carboxylate |
| SMILES | COC(=O)C1=NN(N=O)[C@H]2C(=O)N(c3cccc(C)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C14H12N4O5/c1-7-4-3-5-8(6-7)17-12(19)9-10(14(21)23-2)15-18(16-22)11(9)13(17)20/h3-6,9,11H,1-2H3/t9-,11-/m1/s1 |
| InChIKey | UZPWBSVAGQUZSZ-MWLCHTKSSA-N |
| XLogP | 0.38 |
| TPSA | 108.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|