C29H27N5O5 — CID 98151958
(4S)-4-[(2-hydroxy-5-nitrophenyl)-[(4S)-3-methyl-1-(4-methylphenyl)-5-oxo-4H-pyrazol-4-yl]methyl]-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one (PubChem CID 98151958) has the molecular formula C29H27N5O5 and a molecular weight of 525.57 g/mol. Its IUPAC name is (4S)-4-[(2-hydroxy-5-nitrophenyl)-[(4S)-3-methyl-1-(4-methylphenyl)-5-oxo-4H-pyrazol-4-yl]methyl]-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one.
| Compound Name | (4S)-4-[(2-hydroxy-5-nitrophenyl)-[(4S)-3-methyl-1-(4-methylphenyl)-5-oxo-4H-pyrazol-4-yl]methyl]-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 98151958 |
| Molecular Formula | C29H27N5O5 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | (4S)-4-[(2-hydroxy-5-nitrophenyl)-[(4S)-3-methyl-1-(4-methylphenyl)-5-oxo-4H-pyrazol-4-yl]methyl]-5-methyl-2-(4-methylphenyl)-4H-pyrazol-3-one |
| SMILES | CC1=NN(c2ccc(C)cc2)C(=O)[C@H]1C(c1cc([N+](=O)[O-])ccc1O)[C@@H]1C(=O)N(c2ccc(C)cc2)N=C1C |
| InChI | InChI=1S/C29H27N5O5/c1-16-5-9-20(10-6-16)32-28(36)25(18(3)30-32)27(23-15-22(34(38)39)13-14-24(23)35)26-19(4)31-33(29(26)37)21-11-7-17(2)8-12-21/h5-15,25-27,35H,1-4H3/t25-,26-/m1/s1 |
| InChIKey | YJYOGLFWUVHCQS-CLJLJLNGSA-N |
| XLogP | 5.08 |
| TPSA | 128.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|