C27H21F2N5O5 — CID 1269587
(4R)-2-(4-fluorophenyl)-4-[(S)-[2-(4-fluorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-(2-hydroxy-5-nitrophenyl)methyl]-5-methyl-4H-pyrazol-3-one (PubChem CID 1269587) has the molecular formula C27H21F2N5O5 and a molecular weight of 533.49 g/mol. Its IUPAC name is (4R)-2-(4-fluorophenyl)-4-[(S)-[2-(4-fluorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-(2-hydroxy-5-nitrophenyl)methyl]-5-methyl-4H-pyrazol-3-one.
| Compound Name | (4R)-2-(4-fluorophenyl)-4-[(S)-[2-(4-fluorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-(2-hydroxy-5-nitrophenyl)methyl]-5-methyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 1269587 |
| Molecular Formula | C27H21F2N5O5 |
| Molecular Weight | 533.49 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | (4R)-2-(4-fluorophenyl)-4-[(S)-[2-(4-fluorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-(2-hydroxy-5-nitrophenyl)methyl]-5-methyl-4H-pyrazol-3-one |
| SMILES | CC1=NN(c2ccc(F)cc2)C(=O)[C@@H]1[C@@H](c1cc([N+](=O)[O-])ccc1O)c1c(C)[nH]n(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C27H21F2N5O5/c1-14-23(26(36)32(30-14)18-7-3-16(28)4-8-18)25(21-13-20(34(38)39)11-12-22(21)35)24-15(2)31-33(27(24)37)19-9-5-17(29)6-10-19/h3-13,23,25,31,35H,1-2H3/t23-,25+/m0/s1 |
| InChIKey | IGJKOKYBXDAECN-UKILVPOCSA-N |
| XLogP | 4.54 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|