C27H21Cl2N5O4 — CID 19577974
2-(4-chlorophenyl)-4-[[2-(4-chlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-(4-nitrophenyl)methyl]-5-methyl-1H-pyrazol-3-one (PubChem CID 19577974) has the molecular formula C27H21Cl2N5O4 and a molecular weight of 550.40 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-[[2-(4-chlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-(4-nitrophenyl)methyl]-5-methyl-1H-pyrazol-3-one.
| Compound Name | 2-(4-chlorophenyl)-4-[[2-(4-chlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-(4-nitrophenyl)methyl]-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 19577974 |
| Molecular Formula | C27H21Cl2N5O4 |
| Molecular Weight | 550.40 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | 2-(4-chlorophenyl)-4-[[2-(4-chlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-(4-nitrophenyl)methyl]-5-methyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccc(Cl)cc2)c(=O)c1C(c1ccc([N+](=O)[O-])cc1)c1c(C)[nH]n(-c2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C27H21Cl2N5O4/c1-15-23(26(35)32(30-15)20-11-5-18(28)6-12-20)25(17-3-9-22(10-4-17)34(37)38)24-16(2)31-33(27(24)36)21-13-7-19(29)8-14-21/h3-14,25,30-31H,1-2H3 |
| InChIKey | HTDZUGIZYFZIIX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.40 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|