C31H31N5O4 — CID 98117691
(4R)-2-(3,4-dimethylphenyl)-4-[(S)-[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-(4-nitrophenyl)methyl]-5-methyl-4H-pyrazol-3-one (PubChem CID 98117691) has the molecular formula C31H31N5O4 and a molecular weight of 537.62 g/mol. Its IUPAC name is (4R)-2-(3,4-dimethylphenyl)-4-[(S)-[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-(4-nitrophenyl)methyl]-5-methyl-4H-pyrazol-3-one.
| Compound Name | (4R)-2-(3,4-dimethylphenyl)-4-[(S)-[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-(4-nitrophenyl)methyl]-5-methyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 98117691 |
| Molecular Formula | C31H31N5O4 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | (4R)-2-(3,4-dimethylphenyl)-4-[(S)-[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]-(4-nitrophenyl)methyl]-5-methyl-4H-pyrazol-3-one |
| SMILES | CC1=NN(c2ccc(C)c(C)c2)C(=O)[C@@H]1[C@@H](c1ccc([N+](=O)[O-])cc1)c1c(C)[nH]n(-c2ccc(C)c(C)c2)c1=O |
| InChI | InChI=1S/C31H31N5O4/c1-17-7-11-25(15-19(17)3)34-30(37)27(21(5)32-34)29(23-9-13-24(14-10-23)36(39)40)28-22(6)33-35(31(28)38)26-12-8-18(2)20(4)16-26/h7-16,27,29,33H,1-6H3/t27-,29+/m0/s1 |
| InChIKey | UQVKEFGLRVOVEG-LMSSTIIKSA-N |
| XLogP | 5.79 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|