C25H20N6O6 — CID 71553118
(6R,10S)-1-methyl-6,10-bis(4-nitrophenyl)-3-phenyl-2,3,7,9-tetrazaspiro[4.5]dec-1-ene-4,8-dione (PubChem CID 71553118) has the molecular formula C25H20N6O6 and a molecular weight of 500.47 g/mol. Its IUPAC name is (6R,10S)-1-methyl-6,10-bis(4-nitrophenyl)-3-phenyl-2,3,7,9-tetrazaspiro[4.5]dec-1-ene-4,8-dione.
| Compound Name | (6R,10S)-1-methyl-6,10-bis(4-nitrophenyl)-3-phenyl-2,3,7,9-tetrazaspiro[4.5]dec-1-ene-4,8-dione |
|---|---|
| PubChem CID | 71553118 |
| Molecular Formula | C25H20N6O6 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | (6R,10S)-1-methyl-6,10-bis(4-nitrophenyl)-3-phenyl-2,3,7,9-tetrazaspiro[4.5]dec-1-ene-4,8-dione |
| SMILES | CC1=NN(c2ccccc2)C(=O)C12[C@@H](c1ccc([N+](=O)[O-])cc1)NC(=O)N[C@H]2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H20N6O6/c1-15-25(23(32)29(28-15)18-5-3-2-4-6-18)21(16-7-11-19(12-8-16)30(34)35)26-24(33)27-22(25)17-9-13-20(14-10-17)31(36)37/h2-14,21-22H,1H3,(H2,26,27,33)/t21-,22+,25? |
| InChIKey | SZFGGXMFZAHCCR-OFFJZUQKSA-N |
| XLogP | 4.01 |
| TPSA | 160.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|