C28H25N3O3 — CID 177479430
(6R,12S)-8-methyl-6,10,12-triphenyl-3-oxa-9,10,13-triazadispiro[4.1.47.25]tridec-8-ene-4,11-dione (PubChem CID 177479430) has the molecular formula C28H25N3O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is (6R,12S)-8-methyl-6,10,12-triphenyl-3-oxa-9,10,13-triazadispiro[4.1.47.25]tridec-8-ene-4,11-dione.
| Compound Name | (6R,12S)-8-methyl-6,10,12-triphenyl-3-oxa-9,10,13-triazadispiro[4.1.47.25]tridec-8-ene-4,11-dione |
|---|---|
| PubChem CID | 177479430 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (6R,12S)-8-methyl-6,10,12-triphenyl-3-oxa-9,10,13-triazadispiro[4.1.47.25]tridec-8-ene-4,11-dione |
| SMILES | CC1=NN(c2ccccc2)C(=O)C12C(c1ccccc1)C1(CCOC1=O)N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C28H25N3O3/c1-19-28(25(32)31(30-19)22-15-9-4-10-16-22)23(20-11-5-2-6-12-20)27(17-18-34-26(27)33)29-24(28)21-13-7-3-8-14-21/h2-16,23-24,29H,17-18H2,1H3/t23?,24-,27?,28?/m0/s1 |
| InChIKey | RBBSNGNZMGAQHC-YSYGYCFTSA-N |
| XLogP | 4.21 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |