C27H26N4O3S — CID 139213709
(6S,10S)-6,10-bis(4-methoxyphenyl)-1-methyl-3-phenyl-8-sulfanylidene-2,3,7,9-tetrazaspiro[4.5]dec-1-en-4-one (PubChem CID 139213709) has the molecular formula C27H26N4O3S and a molecular weight of 486.60 g/mol. Its IUPAC name is (6S,10S)-6,10-bis(4-methoxyphenyl)-1-methyl-3-phenyl-8-sulfanylidene-2,3,7,9-tetrazaspiro[4.5]dec-1-en-4-one.
| Compound Name | (6S,10S)-6,10-bis(4-methoxyphenyl)-1-methyl-3-phenyl-8-sulfanylidene-2,3,7,9-tetrazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 139213709 |
| Molecular Formula | C27H26N4O3S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | (6S,10S)-6,10-bis(4-methoxyphenyl)-1-methyl-3-phenyl-8-sulfanylidene-2,3,7,9-tetrazaspiro[4.5]dec-1-en-4-one |
| SMILES | COc1ccc([C@@H]2NC(=S)N[C@@H](c3ccc(OC)cc3)C23C(=O)N(c2ccccc2)N=C3C)cc1 |
| InChI | InChI=1S/C27H26N4O3S/c1-17-27(25(32)31(30-17)20-7-5-4-6-8-20)23(18-9-13-21(33-2)14-10-18)28-26(35)29-24(27)19-11-15-22(34-3)16-12-19/h4-16,23-24H,1-3H3,(H2,28,29,35)/t23-,24-/m0/s1 |
| InChIKey | HVPOKXOTYZELBG-ZEQRLZLVSA-N |
| XLogP | 4.37 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|