C27H22N4O2 — CID 27234906
(5R,6R)-1,10-dimethyl-3,8,11-triphenyl-2,3,8,9-tetrazadispiro[4.0.46.15]undeca-1,9-diene-4,7-dione (PubChem CID 27234906) has the molecular formula C27H22N4O2 and a molecular weight of 434.50 g/mol. Its IUPAC name is (5R,6R)-1,10-dimethyl-3,8,11-triphenyl-2,3,8,9-tetrazadispiro[4.0.46.15]undeca-1,9-diene-4,7-dione.
| Compound Name | (5R,6R)-1,10-dimethyl-3,8,11-triphenyl-2,3,8,9-tetrazadispiro[4.0.46.15]undeca-1,9-diene-4,7-dione |
|---|---|
| PubChem CID | 27234906 |
| Molecular Formula | C27H22N4O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | (5R,6R)-1,10-dimethyl-3,8,11-triphenyl-2,3,8,9-tetrazadispiro[4.0.46.15]undeca-1,9-diene-4,7-dione |
| SMILES | CC1=NN(c2ccccc2)C(=O)[C@@]12C(c1ccccc1)[C@@]21C(=O)N(c2ccccc2)N=C1C |
| InChI | InChI=1S/C27H22N4O2/c1-18-26(24(32)30(28-18)21-14-8-4-9-15-21)23(20-12-6-3-7-13-20)27(26)19(2)29-31(25(27)33)22-16-10-5-11-17-22/h3-17,23H,1-2H3/t26-,27-/m0/s1 |
| InChIKey | RWXPGIAXJOEUPA-SVBPBHIXSA-N |
| XLogP | 4.60 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |