C28H26ClN3O4 — CID 132532313
(5S,6R,8S,9S,10S)-8-(4-chlorophenyl)-6-hydroxy-1,6-dimethyl-9-nitro-3,10-diphenyl-2,3-diazaspiro[4.5]dec-1-en-4-one (PubChem CID 132532313) has the molecular formula C28H26ClN3O4 and a molecular weight of 503.99 g/mol. Its IUPAC name is (5S,6R,8S,9S,10S)-8-(4-chlorophenyl)-6-hydroxy-1,6-dimethyl-9-nitro-3,10-diphenyl-2,3-diazaspiro[4.5]dec-1-en-4-one.
| Compound Name | (5S,6R,8S,9S,10S)-8-(4-chlorophenyl)-6-hydroxy-1,6-dimethyl-9-nitro-3,10-diphenyl-2,3-diazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 132532313 |
| Molecular Formula | C28H26ClN3O4 |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | (5S,6R,8S,9S,10S)-8-(4-chlorophenyl)-6-hydroxy-1,6-dimethyl-9-nitro-3,10-diphenyl-2,3-diazaspiro[4.5]dec-1-en-4-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)[C@@]12[C@H](c1ccccc1)[C@@H]([N+](=O)[O-])[C@H](c1ccc(Cl)cc1)C[C@@]2(C)O |
| InChI | InChI=1S/C28H26ClN3O4/c1-18-28(26(33)31(30-18)22-11-7-4-8-12-22)24(20-9-5-3-6-10-20)25(32(35)36)23(17-27(28,2)34)19-13-15-21(29)16-14-19/h3-16,23-25,34H,17H2,1-2H3/t23-,24+,25-,27+,28-/m0/s1 |
| InChIKey | WUEUMGIUBDVMAO-FRINSPPISA-N |
| XLogP | 5.42 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|