C22H20ClN3O3 — CID 56965008
1-(4-chlorophenyl)-3-(4-ethyl-3-methyl-5-oxo-1-phenylpyrazol-4-yl)pyrrolidine-2,5-dione (PubChem CID 56965008) has the molecular formula C22H20ClN3O3 and a molecular weight of 409.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(4-ethyl-3-methyl-5-oxo-1-phenylpyrazol-4-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(4-chlorophenyl)-3-(4-ethyl-3-methyl-5-oxo-1-phenylpyrazol-4-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 56965008 |
| Molecular Formula | C22H20ClN3O3 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(4-ethyl-3-methyl-5-oxo-1-phenylpyrazol-4-yl)pyrrolidine-2,5-dione |
| SMILES | CCC1(C2CC(=O)N(c3ccc(Cl)cc3)C2=O)C(=O)N(c2ccccc2)N=C1C |
| InChI | InChI=1S/C22H20ClN3O3/c1-3-22(14(2)24-26(21(22)29)17-7-5-4-6-8-17)18-13-19(27)25(20(18)28)16-11-9-15(23)10-12-16/h4-12,18H,3,13H2,1-2H3 |
| InChIKey | PBYWSQVXBRNUSG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|