C27H23ClN4O2S — CID 2859397
(2,5-dioxo-1-phenylpyrrolidin-3-yl) 3-(4-chlorophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carboximidothioate (PubChem CID 2859397) has the molecular formula C27H23ClN4O2S and a molecular weight of 503.03 g/mol. Its IUPAC name is (2,5-dioxo-1-phenylpyrrolidin-3-yl) 3-(4-chlorophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carboximidothioate.
| Compound Name | (2,5-dioxo-1-phenylpyrrolidin-3-yl) 3-(4-chlorophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carboximidothioate |
|---|---|
| PubChem CID | 2859397 |
| Molecular Formula | C27H23ClN4O2S |
| Molecular Weight | 503.03 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | (2,5-dioxo-1-phenylpyrrolidin-3-yl) 3-(4-chlorophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carboximidothioate |
| SMILES | [H]/N=C(\SC1CC(=O)N(c2ccccc2)C1=O)N1N=C(c2ccc(C)cc2)CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H23ClN4O2S/c1-17-7-9-18(10-8-17)22-15-23(19-11-13-20(28)14-12-19)32(30-22)27(29)35-24-16-25(33)31(26(24)34)21-5-3-2-4-6-21/h2-14,23-24,29H,15-16H2,1H3/b29-27- |
| InChIKey | SPBHQNIDJCELJN-OHYPFYFLSA-N |
| XLogP | 5.80 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.03 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|