C25H21BrN4O2S2 — CID 94860730
[(3R)-1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl] (3S)-3-(4-bromophenyl)-5-thiophen-2-yl-3,4-dihydropyrazole-2-carboximidothioate (PubChem CID 94860730) has the molecular formula C25H21BrN4O2S2 and a molecular weight of 553.51 g/mol. Its IUPAC name is [(3R)-1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl] (3S)-3-(4-bromophenyl)-5-thiophen-2-yl-3,4-dihydropyrazole-2-carboximidothioate.
| Compound Name | [(3R)-1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl] (3S)-3-(4-bromophenyl)-5-thiophen-2-yl-3,4-dihydropyrazole-2-carboximidothioate |
|---|---|
| PubChem CID | 94860730 |
| Molecular Formula | C25H21BrN4O2S2 |
| Molecular Weight | 553.51 g/mol |
| Exact Mass | 552.03 |
| IUPAC Name | [(3R)-1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl] (3S)-3-(4-bromophenyl)-5-thiophen-2-yl-3,4-dihydropyrazole-2-carboximidothioate |
| SMILES | [H]/N=C(/S[C@@H]1CC(=O)N(c2cccc(C)c2)C1=O)N1N=C(c2cccs2)C[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H21BrN4O2S2/c1-15-4-2-5-18(12-15)29-23(31)14-22(24(29)32)34-25(27)30-20(16-7-9-17(26)10-8-16)13-19(28-30)21-6-3-11-33-21/h2-12,20,22,27H,13-14H2,1H3/b27-25+/t20-,22+/m0/s1 |
| InChIKey | ZDBPATDNVKOIAZ-VARUUUGESA-N |
| XLogP | 5.97 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|