C28H21BrN4O2S2 — CID 98053189
[(3R)-1-naphthalen-1-yl-2,5-dioxopyrrolidin-3-yl] (3S)-3-(4-bromophenyl)-5-thiophen-2-yl-3,4-dihydropyrazole-2-carboximidothioate (PubChem CID 98053189) has the molecular formula C28H21BrN4O2S2 and a molecular weight of 589.54 g/mol. Its IUPAC name is [(3R)-1-naphthalen-1-yl-2,5-dioxopyrrolidin-3-yl] (3S)-3-(4-bromophenyl)-5-thiophen-2-yl-3,4-dihydropyrazole-2-carboximidothioate.
| Compound Name | [(3R)-1-naphthalen-1-yl-2,5-dioxopyrrolidin-3-yl] (3S)-3-(4-bromophenyl)-5-thiophen-2-yl-3,4-dihydropyrazole-2-carboximidothioate |
|---|---|
| PubChem CID | 98053189 |
| Molecular Formula | C28H21BrN4O2S2 |
| Molecular Weight | 589.54 g/mol |
| Exact Mass | 588.03 |
| IUPAC Name | [(3R)-1-naphthalen-1-yl-2,5-dioxopyrrolidin-3-yl] (3S)-3-(4-bromophenyl)-5-thiophen-2-yl-3,4-dihydropyrazole-2-carboximidothioate |
| SMILES | [H]/N=C(/S[C@@H]1CC(=O)N(c2cccc3ccccc23)C1=O)N1N=C(c2cccs2)C[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C28H21BrN4O2S2/c29-19-12-10-18(11-13-19)23-15-21(24-9-4-14-36-24)31-33(23)28(30)37-25-16-26(34)32(27(25)35)22-8-3-6-17-5-1-2-7-20(17)22/h1-14,23,25,30H,15-16H2/b30-28+/t23-,25+/m0/s1 |
| InChIKey | VZJPCXZVYWNEFE-CDDLHYEHSA-N |
| XLogP | 6.81 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.54 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|