C33H35ClN4O3S — CID 98222762
[(3R)-1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl] (3S)-3-(4-chlorophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carboximidothioate (PubChem CID 98222762) has the molecular formula C33H35ClN4O3S and a molecular weight of 603.19 g/mol. Its IUPAC name is [(3R)-1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl] (3S)-3-(4-chlorophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carboximidothioate.
| Compound Name | [(3R)-1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl] (3S)-3-(4-chlorophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carboximidothioate |
|---|---|
| PubChem CID | 98222762 |
| Molecular Formula | C33H35ClN4O3S |
| Molecular Weight | 603.19 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | [(3R)-1-(4-hexoxyphenyl)-2,5-dioxopyrrolidin-3-yl] (3S)-3-(4-chlorophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole-2-carboximidothioate |
| SMILES | [H]/N=C(/S[C@@H]1CC(=O)N(c2ccc(OCCCCCC)cc2)C1=O)N1N=C(c2ccc(C)cc2)C[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H35ClN4O3S/c1-3-4-5-6-19-41-27-17-15-26(16-18-27)37-31(39)21-30(32(37)40)42-33(35)38-29(24-11-13-25(34)14-12-24)20-28(36-38)23-9-7-22(2)8-10-23/h7-18,29-30,35H,3-6,19-21H2,1-2H3/b35-33+/t29-,30+/m0/s1 |
| InChIKey | RQCHBRYSRRNQAI-ARPUNBORSA-N |
| XLogP | 7.76 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.19 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|