C12H14ClNO4 — CID 51041415
(2R,4R,5R)-4-(4-chlorophenyl)-2-methyl-5-nitrooxan-2-ol (PubChem CID 51041415) has the molecular formula C12H14ClNO4 and a molecular weight of 271.70 g/mol. Its IUPAC name is (2R,4R,5R)-4-(4-chlorophenyl)-2-methyl-5-nitrooxan-2-ol.
| Compound Name | (2R,4R,5R)-4-(4-chlorophenyl)-2-methyl-5-nitrooxan-2-ol |
|---|---|
| PubChem CID | 51041415 |
| Molecular Formula | C12H14ClNO4 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | (2R,4R,5R)-4-(4-chlorophenyl)-2-methyl-5-nitrooxan-2-ol |
| SMILES | C[C@]1(O)C[C@H](c2ccc(Cl)cc2)[C@@H]([N+](=O)[O-])CO1 |
| InChI | InChI=1S/C12H14ClNO4/c1-12(15)6-10(11(7-18-12)14(16)17)8-2-4-9(13)5-3-8/h2-5,10-11,15H,6-7H2,1H3/t10-,11+,12-/m1/s1 |
| InChIKey | ONXBBMPUMCRBHS-GRYCIOLGSA-N |
| XLogP | 2.20 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|