C11H12ClNO4 — CID 23884
2-(4-chlorophenyl)-5-methyl-5-nitro-1,3-dioxane (PubChem CID 23884) has the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-methyl-5-nitro-1,3-dioxane.
| Compound Name | 2-(4-chlorophenyl)-5-methyl-5-nitro-1,3-dioxane |
|---|---|
| PubChem CID | 23884 |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2-(4-chlorophenyl)-5-methyl-5-nitro-1,3-dioxane |
| SMILES | CC1([N+](=O)[O-])COC(c2ccc(Cl)cc2)OC1 |
| InChI | InChI=1S/C11H12ClNO4/c1-11(13(14)15)6-16-10(17-7-11)8-2-4-9(12)5-3-8/h2-5,10H,6-7H2,1H3 |
| InChIKey | MMHGEVPLISXPCY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|