C10H11NO4 — CID 12768841
5-nitro-2-phenyl-1,3-dioxane (PubChem CID 12768841) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is 5-nitro-2-phenyl-1,3-dioxane.
| Compound Name | 5-nitro-2-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 12768841 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 5-nitro-2-phenyl-1,3-dioxane |
| SMILES | O=[N+]([O-])C1COC(c2ccccc2)OC1 |
| InChI | InChI=1S/C10H11NO4/c12-11(13)9-6-14-10(15-7-9)8-4-2-1-3-5-8/h1-5,9-10H,6-7H2 |
| InChIKey | GCSCZKPGTYADSA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|