C18H15Cl2NO3 — CID 132570421
trans-(3S,5S)-3,5-bis(4-chlorophenyl)-4-nitrocyclohexan-1-one (PubChem CID 132570421) has the molecular formula C18H15Cl2NO3 and a molecular weight of 364.23 g/mol. Its IUPAC name is trans-(3S,5S)-3,5-bis(4-chlorophenyl)-4-nitrocyclohexan-1-one.
| Compound Name | trans-(3S,5S)-3,5-bis(4-chlorophenyl)-4-nitrocyclohexan-1-one |
|---|---|
| PubChem CID | 132570421 |
| Molecular Formula | C18H15Cl2NO3 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | trans-(3S,5S)-3,5-bis(4-chlorophenyl)-4-nitrocyclohexan-1-one |
| SMILES | O=C1C[C@@H](c2ccc(Cl)cc2)C([N+](=O)[O-])[C@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H15Cl2NO3/c19-13-5-1-11(2-6-13)16-9-15(22)10-17(18(16)21(23)24)12-3-7-14(20)8-4-12/h1-8,16-18H,9-10H2/t16-,17-/m0/s1 |
| InChIKey | AUFFRQRLBVQAOX-IRXDYDNUSA-N |
| XLogP | 4.87 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|