C20H18BrNO3 — CID 139048530
(3S,4R,5S)-3-[(E)-2-(4-bromophenyl)ethenyl]-4-nitro-5-phenylcyclohexan-1-one (PubChem CID 139048530) has the molecular formula C20H18BrNO3 and a molecular weight of 400.27 g/mol. Its IUPAC name is (3S,4R,5S)-3-[(E)-2-(4-bromophenyl)ethenyl]-4-nitro-5-phenylcyclohexan-1-one.
| Compound Name | (3S,4R,5S)-3-[(E)-2-(4-bromophenyl)ethenyl]-4-nitro-5-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 139048530 |
| Molecular Formula | C20H18BrNO3 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | (3S,4R,5S)-3-[(E)-2-(4-bromophenyl)ethenyl]-4-nitro-5-phenylcyclohexan-1-one |
| SMILES | O=C1C[C@@H](/C=C/c2ccc(Br)cc2)[C@@H]([N+](=O)[O-])[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C20H18BrNO3/c21-17-10-7-14(8-11-17)6-9-16-12-18(23)13-19(20(16)22(24)25)15-4-2-1-3-5-15/h1-11,16,19-20H,12-13H2/b9-6+/t16-,19+,20-/m1/s1 |
| InChIKey | UITHNCAIHXOHEG-QTEOXSJISA-N |
| XLogP | 4.87 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|