C14H12N6O12 — CID 154135688
1,1,3,3,5,5-hexanitro-2-(2-phenylethenyl)cyclohexane (PubChem CID 154135688) has the molecular formula C14H12N6O12 and a molecular weight of 456.28 g/mol. Its IUPAC name is 1,1,3,3,5,5-hexanitro-2-(2-phenylethenyl)cyclohexane.
| Compound Name | 1,1,3,3,5,5-hexanitro-2-(2-phenylethenyl)cyclohexane |
|---|---|
| PubChem CID | 154135688 |
| Molecular Formula | C14H12N6O12 |
| Molecular Weight | 456.28 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 1,1,3,3,5,5-hexanitro-2-(2-phenylethenyl)cyclohexane |
| SMILES | O=[N+]([O-])C1([N+](=O)[O-])CC([N+](=O)[O-])([N+](=O)[O-])C(C=Cc2ccccc2)C([N+](=O)[O-])([N+](=O)[O-])C1 |
| InChI | InChI=1S/C14H12N6O12/c21-15(22)12(16(23)24)8-13(17(25)26,18(27)28)11(7-6-10-4-2-1-3-5-10)14(9-12,19(29)30)20(31)32/h1-7,11H,8-9H2 |
| InChIKey | QLYNAAKKYUZEGZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 258.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|