C6H6N6O12 — CID 161094538
1,1,3,3,5,5-hexanitrocyclohexane (PubChem CID 161094538) has the molecular formula C6H6N6O12 and a molecular weight of 354.14 g/mol. Its IUPAC name is 1,1,3,3,5,5-hexanitrocyclohexane.
| Compound Name | 1,1,3,3,5,5-hexanitrocyclohexane |
|---|---|
| PubChem CID | 161094538 |
| Molecular Formula | C6H6N6O12 |
| Molecular Weight | 354.14 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 1,1,3,3,5,5-hexanitrocyclohexane |
| SMILES | O=[N+]([O-])C1([N+](=O)[O-])CC([N+](=O)[O-])([N+](=O)[O-])CC([N+](=O)[O-])([N+](=O)[O-])C1 |
| InChI | InChI=1S/C6H6N6O12/c13-7(14)4(8(15)16)1-5(9(17)18,10(19)20)3-6(2-4,11(21)22)12(23)24/h1-3H2 |
| InChIKey | MHAZXXJWJDAIFH-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 258.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.14 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|