C8H14N4O5 — CID 59900795
1,5-dimethyl-7,7-dinitro-1,5-diazocan-3-one (PubChem CID 59900795) has the molecular formula C8H14N4O5 and a molecular weight of 246.22 g/mol. Its IUPAC name is 1,5-dimethyl-7,7-dinitro-1,5-diazocan-3-one.
| Compound Name | 1,5-dimethyl-7,7-dinitro-1,5-diazocan-3-one |
|---|---|
| PubChem CID | 59900795 |
| Molecular Formula | C8H14N4O5 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1,5-dimethyl-7,7-dinitro-1,5-diazocan-3-one |
| SMILES | CN1CC(=O)CN(C)CC([N+](=O)[O-])([N+](=O)[O-])C1 |
| InChI | InChI=1S/C8H14N4O5/c1-9-3-7(13)4-10(2)6-8(5-9,11(14)15)12(16)17/h3-6H2,1-2H3 |
| InChIKey | PBVZKXXXHUBQCB-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|