About 1,5-dimethyl-7,7-dinitro-1,5-diazocan-3-one
1,5-dimethyl-7,7-dinitro-1,5-diazocan-3-one (PubChem CID 59900795) has the molecular formula C8H14N4O5
and a molecular weight of 246.22 g/mol. Its IUPAC name is 1,5-dimethyl-7,7-dinitro-1,5-diazocan-3-one.
Molecular Properties
| Compound Name | 1,5-dimethyl-7,7-dinitro-1,5-diazocan-3-one |
| PubChem CID | 59900795 |
| Molecular Formula | C8H14N4O5 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1,5-dimethyl-7,7-dinitro-1,5-diazocan-3-one |
| SMILES | CN1CC(=O)CN(C)CC([N+](=O)[O-])([N+](=O)[O-])C1 |
| InChI | InChI=1S/C8H14N4O5/c1-9-3-7(13)4-10(2)6-8(5-9,11(14)15)12(16)17/h3-6H2,1-2H3 |
| InChIKey | PBVZKXXXHUBQCB-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dimethyl-7,7-dinitro-1,5-diazocan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-7,7-dinitro-1,5-diazocan-3-one?
The IUPAC name of 1,5-dimethyl-7,7-dinitro-1,5-diazocan-3-one (CID 59900795) is 1,5-dimethyl-7,7-dinitro-1,5-diazocan-3-one.
What is the SMILES notation for 1,5-dimethyl-7,7-dinitro-1,5-diazocan-3-one?
The canonical SMILES for 1,5-dimethyl-7,7-dinitro-1,5-diazocan-3-one is CN1CC(=O)CN(C)CC([N+](=O)[O-])([N+](=O)[O-])C1.
What is the InChIKey of 1,5-dimethyl-7,7-dinitro-1,5-diazocan-3-one?
The InChIKey is PBVZKXXXHUBQCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O5/c1-9-3-7(13)4-10(2)6-8(5-9,11(14)15)12(16)17/h3-6H2,1-2H3.
What are the key properties of 1,5-dimethyl-7,7-dinitro-1,5-diazocan-3-one?
1,5-dimethyl-7,7-dinitro-1,5-diazocan-3-one has a molecular weight of 246.22 g/mol, XLogP of -1.32, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-7,7-dinitro-1,5-diazocan-3-one is sourced from PubChem (CID 59900795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).