C14H20N6O10 — CID 4913494
1-[4-(5,5-dinitro-2-oxopiperidin-1-yl)butyl]-5,5-dinitropiperidin-2-one (PubChem CID 4913494) has the molecular formula C14H20N6O10 and a molecular weight of 432.35 g/mol. Its IUPAC name is 1-[4-(5,5-dinitro-2-oxopiperidin-1-yl)butyl]-5,5-dinitropiperidin-2-one.
| Compound Name | 1-[4-(5,5-dinitro-2-oxopiperidin-1-yl)butyl]-5,5-dinitropiperidin-2-one |
|---|---|
| PubChem CID | 4913494 |
| Molecular Formula | C14H20N6O10 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 1-[4-(5,5-dinitro-2-oxopiperidin-1-yl)butyl]-5,5-dinitropiperidin-2-one |
| SMILES | O=C1CCC([N+](=O)[O-])([N+](=O)[O-])CN1CCCCN1CC([N+](=O)[O-])([N+](=O)[O-])CCC1=O |
| InChI | InChI=1S/C14H20N6O10/c21-11-3-5-13(17(23)24,18(25)26)9-15(11)7-1-2-8-16-10-14(19(27)28,20(29)30)6-4-12(16)22/h1-10H2 |
| InChIKey | HZSWLACSLSQLNJ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 213.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|