C16H32N2O — CID 106708430
1-(6-amino-5,5-dimethylhexyl)-5,5-dimethylazepan-2-one (PubChem CID 106708430) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is 1-(6-amino-5,5-dimethylhexyl)-5,5-dimethylazepan-2-one.
| Compound Name | 1-(6-amino-5,5-dimethylhexyl)-5,5-dimethylazepan-2-one |
|---|---|
| PubChem CID | 106708430 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | 1-(6-amino-5,5-dimethylhexyl)-5,5-dimethylazepan-2-one |
| SMILES | CC(C)(CN)CCCCN1CCC(C)(C)CCC1=O |
| InChI | InChI=1S/C16H32N2O/c1-15(2)9-7-14(19)18(12-10-15)11-6-5-8-16(3,4)13-17/h5-13,17H2,1-4H3 |
| InChIKey | JGXHZGKTTKGOHQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|