C14H28N2O — CID 65286653
1-(4-amino-3,3-dimethylbutyl)-5,5-dimethylazepan-2-one (PubChem CID 65286653) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is 1-(4-amino-3,3-dimethylbutyl)-5,5-dimethylazepan-2-one.
| Compound Name | 1-(4-amino-3,3-dimethylbutyl)-5,5-dimethylazepan-2-one |
|---|---|
| PubChem CID | 65286653 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 1-(4-amino-3,3-dimethylbutyl)-5,5-dimethylazepan-2-one |
| SMILES | CC(C)(CN)CCN1CCC(C)(C)CCC1=O |
| InChI | InChI=1S/C14H28N2O/c1-13(2)6-5-12(17)16(9-7-13)10-8-14(3,4)11-15/h5-11,15H2,1-4H3 |
| InChIKey | WGRGDNKMIHSKNA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |