About 2-[1-[(5,5-dimethyl-2-oxoazepan-1-yl)methyl]cyclopropyl]acetonitrile
2-[1-[(5,5-dimethyl-2-oxoazepan-1-yl)methyl]cyclopropyl]acetonitrile (PubChem CID 65493027) has the molecular formula C14H22N2O
and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-[1-[(5,5-dimethyl-2-oxoazepan-1-yl)methyl]cyclopropyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[1-[(5,5-dimethyl-2-oxoazepan-1-yl)methyl]cyclopropyl]acetonitrile |
| PubChem CID | 65493027 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 2-[1-[(5,5-dimethyl-2-oxoazepan-1-yl)methyl]cyclopropyl]acetonitrile |
| SMILES | CC1(C)CCC(=O)N(CC2(CC#N)CC2)CC1 |
| InChI | InChI=1S/C14H22N2O/c1-13(2)4-3-12(17)16(10-8-13)11-14(5-6-14)7-9-15/h3-8,10-11H2,1-2H3 |
| InChIKey | NJROSTJVQOEPRZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1-[(5,5-dimethyl-2-oxoazepan-1-yl)methyl]cyclopropyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(5,5-dimethyl-2-oxoazepan-1-yl)methyl]cyclopropyl]acetonitrile?
The IUPAC name of 2-[1-[(5,5-dimethyl-2-oxoazepan-1-yl)methyl]cyclopropyl]acetonitrile (CID 65493027) is 2-[1-[(5,5-dimethyl-2-oxoazepan-1-yl)methyl]cyclopropyl]acetonitrile.
What is the SMILES notation for 2-[1-[(5,5-dimethyl-2-oxoazepan-1-yl)methyl]cyclopropyl]acetonitrile?
The canonical SMILES for 2-[1-[(5,5-dimethyl-2-oxoazepan-1-yl)methyl]cyclopropyl]acetonitrile is CC1(C)CCC(=O)N(CC2(CC#N)CC2)CC1.
What is the InChIKey of 2-[1-[(5,5-dimethyl-2-oxoazepan-1-yl)methyl]cyclopropyl]acetonitrile?
The InChIKey is NJROSTJVQOEPRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O/c1-13(2)4-3-12(17)16(10-8-13)11-14(5-6-14)7-9-15/h3-8,10-11H2,1-2H3.
What are the key properties of 2-[1-[(5,5-dimethyl-2-oxoazepan-1-yl)methyl]cyclopropyl]acetonitrile?
2-[1-[(5,5-dimethyl-2-oxoazepan-1-yl)methyl]cyclopropyl]acetonitrile has a molecular weight of 234.34 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(5,5-dimethyl-2-oxoazepan-1-yl)methyl]cyclopropyl]acetonitrile is sourced from PubChem (CID 65493027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).