C13H21NO3 — CID 77064595
4-(5,5-dimethyl-2-oxoazepan-1-yl)-3-methylbut-2-enoic acid (PubChem CID 77064595) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 4-(5,5-dimethyl-2-oxoazepan-1-yl)-3-methylbut-2-enoic acid.
| Compound Name | 4-(5,5-dimethyl-2-oxoazepan-1-yl)-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 77064595 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 4-(5,5-dimethyl-2-oxoazepan-1-yl)-3-methylbut-2-enoic acid |
| SMILES | CC(=CC(=O)O)CN1CCC(C)(C)CCC1=O |
| InChI | InChI=1S/C13H21NO3/c1-10(8-12(16)17)9-14-7-6-13(2,3)5-4-11(14)15/h8H,4-7,9H2,1-3H3,(H,16,17) |
| InChIKey | PGDTTZYKRDXPPR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|