C16H19F2NO2 — CID 65284383
1-[2-(2,5-difluorophenyl)-2-oxoethyl]-5,5-dimethylazepan-2-one (PubChem CID 65284383) has the molecular formula C16H19F2NO2 and a molecular weight of 295.33 g/mol. Its IUPAC name is 1-[2-(2,5-difluorophenyl)-2-oxoethyl]-5,5-dimethylazepan-2-one.
| Compound Name | 1-[2-(2,5-difluorophenyl)-2-oxoethyl]-5,5-dimethylazepan-2-one |
|---|---|
| PubChem CID | 65284383 |
| Molecular Formula | C16H19F2NO2 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-[2-(2,5-difluorophenyl)-2-oxoethyl]-5,5-dimethylazepan-2-one |
| SMILES | CC1(C)CCC(=O)N(CC(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C16H19F2NO2/c1-16(2)6-5-15(21)19(8-7-16)10-14(20)12-9-11(17)3-4-13(12)18/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | NEHDHNKTMIKTIB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |