C17H23NO3 — CID 65284721
1-[2-(3-methoxyphenyl)-2-oxoethyl]-5,5-dimethylazepan-2-one (PubChem CID 65284721) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-[2-(3-methoxyphenyl)-2-oxoethyl]-5,5-dimethylazepan-2-one.
| Compound Name | 1-[2-(3-methoxyphenyl)-2-oxoethyl]-5,5-dimethylazepan-2-one |
|---|---|
| PubChem CID | 65284721 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 1-[2-(3-methoxyphenyl)-2-oxoethyl]-5,5-dimethylazepan-2-one |
| SMILES | COc1cccc(C(=O)CN2CCC(C)(C)CCC2=O)c1 |
| InChI | InChI=1S/C17H23NO3/c1-17(2)8-7-16(20)18(10-9-17)12-15(19)13-5-4-6-14(11-13)21-3/h4-6,11H,7-10,12H2,1-3H3 |
| InChIKey | FJLUGHUYKNOYDA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |