C16H20FNO2 — CID 65284577
1-[2-(4-fluorophenyl)-2-oxoethyl]-5,5-dimethylazepan-2-one (PubChem CID 65284577) has the molecular formula C16H20FNO2 and a molecular weight of 277.34 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-2-oxoethyl]-5,5-dimethylazepan-2-one.
| Compound Name | 1-[2-(4-fluorophenyl)-2-oxoethyl]-5,5-dimethylazepan-2-one |
|---|---|
| PubChem CID | 65284577 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-2-oxoethyl]-5,5-dimethylazepan-2-one |
| SMILES | CC1(C)CCC(=O)N(CC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H20FNO2/c1-16(2)8-7-15(20)18(10-9-16)11-14(19)12-3-5-13(17)6-4-12/h3-6H,7-11H2,1-2H3 |
| InChIKey | QRTAPUACUCYJAG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |