C12H13F2NOS — CID 62053520
1-(2,5-difluorophenyl)-2-thiomorpholin-4-ylethanone (PubChem CID 62053520) has the molecular formula C12H13F2NOS and a molecular weight of 257.30 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-thiomorpholin-4-ylethanone.
| Compound Name | 1-(2,5-difluorophenyl)-2-thiomorpholin-4-ylethanone |
|---|---|
| PubChem CID | 62053520 |
| Molecular Formula | C12H13F2NOS |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-thiomorpholin-4-ylethanone |
| SMILES | O=C(CN1CCSCC1)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H13F2NOS/c13-9-1-2-11(14)10(7-9)12(16)8-15-3-5-17-6-4-15/h1-2,7H,3-6,8H2 |
| InChIKey | VNYCANVFYLHFRQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |