About 1-methylazetidin-2-one;1-methylazetidin-3-one
1-methylazetidin-2-one;1-methylazetidin-3-one (PubChem CID 160543934) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 1-methylazetidin-2-one;1-methylazetidin-3-one.
Molecular Properties
| Compound Name | 1-methylazetidin-2-one;1-methylazetidin-3-one |
| PubChem CID | 160543934 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 1-methylazetidin-2-one;1-methylazetidin-3-one |
| SMILES | CN1CC(=O)C1.CN1CCC1=O |
| InChI | InChI=1S/2C4H7NO/c1-5-2-4(6)3-5;1-5-3-2-4(5)6/h2*2-3H2,1H3 |
| InChIKey | QXEAPJUUKGFWKO-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylazetidin-2-one;1-methylazetidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylazetidin-2-one;1-methylazetidin-3-one?
The IUPAC name of 1-methylazetidin-2-one;1-methylazetidin-3-one (CID 160543934) is 1-methylazetidin-2-one;1-methylazetidin-3-one.
What is the SMILES notation for 1-methylazetidin-2-one;1-methylazetidin-3-one?
The canonical SMILES for 1-methylazetidin-2-one;1-methylazetidin-3-one is CN1CC(=O)C1.CN1CCC1=O.
What is the InChIKey of 1-methylazetidin-2-one;1-methylazetidin-3-one?
The InChIKey is QXEAPJUUKGFWKO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H7NO/c1-5-2-4(6)3-5;1-5-3-2-4(5)6/h2*2-3H2,1H3.
What are the key properties of 1-methylazetidin-2-one;1-methylazetidin-3-one?
1-methylazetidin-2-one;1-methylazetidin-3-one has a molecular weight of 170.21 g/mol, XLogP of -0.65, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylazetidin-2-one;1-methylazetidin-3-one is sourced from PubChem (CID 160543934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).