C7H11NO2 — CID 154317787
1-methylazepane-4,5-dione (PubChem CID 154317787) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is 1-methylazepane-4,5-dione.
| Compound Name | 1-methylazepane-4,5-dione |
|---|---|
| PubChem CID | 154317787 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 1-methylazepane-4,5-dione |
| SMILES | CN1CCC(=O)C(=O)CC1 |
| InChI | InChI=1S/C7H11NO2/c1-8-4-2-6(9)7(10)3-5-8/h2-5H2,1H3 |
| InChIKey | VFZJKBPCBPYHFD-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|