About 3-hydroxydioxaborirane;1-methylpiperidin-4-one
3-hydroxydioxaborirane;1-methylpiperidin-4-one (PubChem CID 91574741) has the molecular formula C6H12BNO4
and a molecular weight of 172.98 g/mol. Its IUPAC name is 3-hydroxydioxaborirane;1-methylpiperidin-4-one.
Molecular Properties
| Compound Name | 3-hydroxydioxaborirane;1-methylpiperidin-4-one |
| PubChem CID | 91574741 |
| Molecular Formula | C6H12BNO4 |
| Molecular Weight | 172.98 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | 3-hydroxydioxaborirane;1-methylpiperidin-4-one |
| SMILES | CN1CCC(=O)CC1.OB1OO1 |
| InChI | InChI=1S/C6H11NO.BHO3/c1-7-4-2-6(8)3-5-7;2-1-3-4-1/h2-5H2,1H3;2H |
| InChIKey | KQFZKGGBSHSOPG-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.98 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxydioxaborirane;1-methylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxydioxaborirane;1-methylpiperidin-4-one?
The IUPAC name of 3-hydroxydioxaborirane;1-methylpiperidin-4-one (CID 91574741) is 3-hydroxydioxaborirane;1-methylpiperidin-4-one.
What is the SMILES notation for 3-hydroxydioxaborirane;1-methylpiperidin-4-one?
The canonical SMILES for 3-hydroxydioxaborirane;1-methylpiperidin-4-one is CN1CCC(=O)CC1.OB1OO1.
What is the InChIKey of 3-hydroxydioxaborirane;1-methylpiperidin-4-one?
The InChIKey is KQFZKGGBSHSOPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.BHO3/c1-7-4-2-6(8)3-5-7;2-1-3-4-1/h2-5H2,1H3;2H.
What are the key properties of 3-hydroxydioxaborirane;1-methylpiperidin-4-one?
3-hydroxydioxaborirane;1-methylpiperidin-4-one has a molecular weight of 172.98 g/mol, XLogP of -0.79, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxydioxaborirane;1-methylpiperidin-4-one is sourced from PubChem (CID 91574741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).