C4H7N3O4 — CID 88534952
1-methyl-3,3-dinitroazetidine (PubChem CID 88534952) has the molecular formula C4H7N3O4 and a molecular weight of 161.12 g/mol. Its IUPAC name is 1-methyl-3,3-dinitroazetidine.
| Compound Name | 1-methyl-3,3-dinitroazetidine |
|---|---|
| PubChem CID | 88534952 |
| Molecular Formula | C4H7N3O4 |
| Molecular Weight | 161.12 g/mol |
| Exact Mass | 161.04 |
| IUPAC Name | 1-methyl-3,3-dinitroazetidine |
| SMILES | CN1CC([N+](=O)[O-])([N+](=O)[O-])C1 |
| InChI | InChI=1S/C4H7N3O4/c1-5-2-4(3-5,6(8)9)7(10)11/h2-3H2,1H3 |
| InChIKey | URVRIBRYNFCGEV-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.12 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|