C11H17N3O4 — CID 4115153
3,8,9-trimethyl-1,5-dinitro-3-azabicyclo[3.3.1]non-6-ene (PubChem CID 4115153) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is 3,8,9-trimethyl-1,5-dinitro-3-azabicyclo[3.3.1]non-6-ene.
| Compound Name | 3,8,9-trimethyl-1,5-dinitro-3-azabicyclo[3.3.1]non-6-ene |
|---|---|
| PubChem CID | 4115153 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 3,8,9-trimethyl-1,5-dinitro-3-azabicyclo[3.3.1]non-6-ene |
| SMILES | CC1C=CC2([N+](=O)[O-])CN(C)CC1([N+](=O)[O-])C2C |
| InChI | InChI=1S/C11H17N3O4/c1-8-4-5-10(13(15)16)6-12(3)7-11(8,9(10)2)14(17)18/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | ODIZRZKFOUMOQL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|