About 2-methyl-3-nitro-3,4-dihydropyrazol-1-ium
2-methyl-3-nitro-3,4-dihydropyrazol-1-ium (PubChem CID 173057194) has the molecular formula C4H8N3O2+
and a molecular weight of 130.13 g/mol. Its IUPAC name is 2-methyl-3-nitro-3,4-dihydropyrazol-1-ium.
Molecular Properties
| Compound Name | 2-methyl-3-nitro-3,4-dihydropyrazol-1-ium |
| PubChem CID | 173057194 |
| Molecular Formula | C4H8N3O2+ |
| Molecular Weight | 130.13 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 2-methyl-3-nitro-3,4-dihydropyrazol-1-ium |
| SMILES | CN1[NH+]=CCC1[N+](=O)[O-] |
| InChI | InChI=1S/C4H7N3O2/c1-6-4(7(8)9)2-3-5-6/h3-4H,2H2,1H3/p+1 |
| InChIKey | VMHLUXRFTXRVGM-UHFFFAOYSA-O |
| XLogP | -2.01 |
| TPSA | 60.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.13 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-nitro-3,4-dihydropyrazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-nitro-3,4-dihydropyrazol-1-ium?
The IUPAC name of 2-methyl-3-nitro-3,4-dihydropyrazol-1-ium (CID 173057194) is 2-methyl-3-nitro-3,4-dihydropyrazol-1-ium.
What is the SMILES notation for 2-methyl-3-nitro-3,4-dihydropyrazol-1-ium?
The canonical SMILES for 2-methyl-3-nitro-3,4-dihydropyrazol-1-ium is CN1[NH+]=CCC1[N+](=O)[O-].
What is the InChIKey of 2-methyl-3-nitro-3,4-dihydropyrazol-1-ium?
The InChIKey is VMHLUXRFTXRVGM-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H7N3O2/c1-6-4(7(8)9)2-3-5-6/h3-4H,2H2,1H3/p+1.
What are the key properties of 2-methyl-3-nitro-3,4-dihydropyrazol-1-ium?
2-methyl-3-nitro-3,4-dihydropyrazol-1-ium has a molecular weight of 130.13 g/mol, XLogP of -2.01, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-nitro-3,4-dihydropyrazol-1-ium is sourced from PubChem (CID 173057194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).